C26H29NO — CID 7671231
N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]-2,2-diphenylacetamide (PubChem CID 7671231) has the molecular formula C26H29NO and a molecular weight of 371.52 g/mol. Its IUPAC name is N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]-2,2-diphenylacetamide.
| Compound Name | N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 7671231 |
| Molecular Formula | C26H29NO |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]-2,2-diphenylacetamide |
| SMILES | CCc1ccc([C@H](NC(=O)C(c2ccccc2)c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C26H29NO/c1-4-20-15-17-23(18-16-20)25(19(2)3)27-26(28)24(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-19,24-25H,4H2,1-3H3,(H,27,28)/t25-/m1/s1 |
| InChIKey | QAXCUHKEAJFFNG-RUZDIDTESA-N |
| XLogP | 5.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |