C23H25NO — CID 7671180
N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]naphthalene-2-carboxamide (PubChem CID 7671180) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]naphthalene-2-carboxamide.
| Compound Name | N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 7671180 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]naphthalene-2-carboxamide |
| SMILES | CCc1ccc([C@H](NC(=O)c2ccc3ccccc3c2)C(C)C)cc1 |
| InChI | InChI=1S/C23H25NO/c1-4-17-9-11-19(12-10-17)22(16(2)3)24-23(25)21-14-13-18-7-5-6-8-20(18)15-21/h5-16,22H,4H2,1-3H3,(H,24,25)/t22-/m1/s1 |
| InChIKey | HJJXYJDGWUVHIF-JOCHJYFZSA-N |
| XLogP | 5.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |