C16H21N2O3+ — CID 8786631
2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-prop-2-ynylacetamide (PubChem CID 8786631) has the molecular formula C16H21N2O3+ and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-prop-2-ynylacetamide.
| Compound Name | 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 8786631 |
| Molecular Formula | C16H21N2O3+ |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)C[NH+]1CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C16H20N2O3/c1-4-6-17-16(19)11-18-7-5-12-8-14(20-2)15(21-3)9-13(12)10-18/h1,8-9H,5-7,10-11H2,2-3H3,(H,17,19)/p+1 |
| InChIKey | WTNCATDBIVTSOH-UHFFFAOYSA-O |
| XLogP | -0.61 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|