C25H33N2O3+ — CID 8786586
2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide (PubChem CID 8786586) has the molecular formula C25H33N2O3+ and a molecular weight of 409.55 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide.
| Compound Name | 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 8786586 |
| Molecular Formula | C25H33N2O3+ |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide |
| SMILES | COc1cc2c(cc1OC)C[NH+](CC(=O)N[C@@H](C)c1ccc3c(c1)CCCC3)CC2 |
| InChI | InChI=1S/C25H32N2O3/c1-17(19-9-8-18-6-4-5-7-20(18)12-19)26-25(28)16-27-11-10-21-13-23(29-2)24(30-3)14-22(21)15-27/h8-9,12-14,17H,4-7,10-11,15-16H2,1-3H3,(H,26,28)/p+1/t17-/m0/s1 |
| InChIKey | GKCGPIMUJSQLQX-KRWDZBQOSA-O |
| XLogP | 2.40 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |