C20H23ClN3O4+ — CID 2467877
4-chloro-N'-[2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)acetyl]benzohydrazide (PubChem CID 2467877) has the molecular formula C20H23ClN3O4+ and a molecular weight of 404.87 g/mol. Its IUPAC name is 4-chloro-N'-[2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 2467877 |
| Molecular Formula | C20H23ClN3O4+ |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 4-chloro-N'-[2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)acetyl]benzohydrazide |
| SMILES | COc1cc2c(cc1OC)C[NH+](CC(=O)NNC(=O)c1ccc(Cl)cc1)CC2 |
| InChI | InChI=1S/C20H22ClN3O4/c1-27-17-9-14-7-8-24(11-15(14)10-18(17)28-2)12-19(25)22-23-20(26)13-3-5-16(21)6-4-13/h3-6,9-10H,7-8,11-12H2,1-2H3,(H,22,25)(H,23,26)/p+1 |
| InChIKey | TYDZZKGGKUTAEM-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|