C18H23N3O5 — CID 7940070
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate (PubChem CID 7940070) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 7940070 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
| SMILES | N#CC1(NC(=O)COC(=O)CN2C(=O)[C@H]3CCCC[C@@H]3C2=O)CCCC1 |
| InChI | InChI=1S/C18H23N3O5/c19-11-18(7-3-4-8-18)20-14(22)10-26-15(23)9-21-16(24)12-5-1-2-6-13(12)17(21)25/h12-13H,1-10H2,(H,20,22)/t12-,13-/m0/s1 |
| InChIKey | UDZVGVZFFHXHMA-STQMWFEESA-N |
| XLogP | 0.66 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|