C21H24N4O5 — CID 7708839
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate (PubChem CID 7708839) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7708839 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate |
| SMILES | C[C@]1(c2ccccc2)NC(=O)N(CC(=O)OCC(=O)NC2(C#N)CCCCC2)C1=O |
| InChI | InChI=1S/C21H24N4O5/c1-20(15-8-4-2-5-9-15)18(28)25(19(29)24-20)12-17(27)30-13-16(26)23-21(14-22)10-6-3-7-11-21/h2,4-5,8-9H,3,6-7,10-13H2,1H3,(H,23,26)(H,24,29)/t20-/m1/s1 |
| InChIKey | BLHVWVZHGKKCME-HXUWFJFHSA-N |
| XLogP | 1.34 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|