C19H21N5O5 — CID 7431279
N-(1-cyanocyclohexyl)-2-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 7431279) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7431279 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@]1(c2ccc([N+](=O)[O-])cc2)NC(=O)N(CC(=O)NC2(C#N)CCCCC2)C1=O |
| InChI | InChI=1S/C19H21N5O5/c1-18(13-5-7-14(8-6-13)24(28)29)16(26)23(17(27)22-18)11-15(25)21-19(12-20)9-3-2-4-10-19/h5-8H,2-4,9-11H2,1H3,(H,21,25)(H,22,27)/t18-/m0/s1 |
| InChIKey | WKOYAJJIHANLEH-SFHVURJKSA-N |
| XLogP | 1.70 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|