C18H19N5O5 — CID 7180255
N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 7180255) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7180255 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(c2ccc([N+](=O)[O-])cc2)NC(=O)N(CC(=O)N[C@@](C)(C#N)C2CC2)C1=O |
| InChI | InChI=1S/C18H19N5O5/c1-17(10-19,11-3-4-11)20-14(24)9-22-15(25)18(2,21-16(22)26)12-5-7-13(8-6-12)23(27)28/h5-8,11H,3-4,9H2,1-2H3,(H,20,24)(H,21,26)/t17-,18+/m0/s1 |
| InChIKey | UPDQUPBXYVBSNE-ZWKOTPCHSA-N |
| XLogP | 1.17 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|