C21H25FN4O3 — CID 7621415
2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-cyano-1-cyclopropylethyl]acetamide (PubChem CID 7621415) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is 2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-cyano-1-cyclopropylethyl]acetamide.
| Compound Name | 2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-cyano-1-cyclopropylethyl]acetamide |
|---|---|
| PubChem CID | 7621415 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-cyano-1-cyclopropylethyl]acetamide |
| SMILES | CCCC[C@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)N[C@](C)(C#N)C2CC2)C1=O |
| InChI | InChI=1S/C21H25FN4O3/c1-3-4-11-21(15-7-9-16(22)10-8-15)18(28)26(19(29)25-21)12-17(27)24-20(2,13-23)14-5-6-14/h7-10,14H,3-6,11-12H2,1-2H3,(H,24,27)(H,25,29)/t20-,21-/m1/s1 |
| InChIKey | JEQXIQYRLZTHLQ-NHCUHLMSSA-N |
| XLogP | 2.57 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|