C14H19BrF3NO — CID 102603283
2-(3-bromo-1-adamantyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 102603283) has the molecular formula C14H19BrF3NO and a molecular weight of 354.21 g/mol. Its IUPAC name is 2-(3-bromo-1-adamantyl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(3-bromo-1-adamantyl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 102603283 |
| Molecular Formula | C14H19BrF3NO |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-(3-bromo-1-adamantyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(Br)(C3)C1)C2)NCC(F)(F)F |
| InChI | InChI=1S/C14H19BrF3NO/c15-13-4-9-1-10(5-13)3-12(2-9,7-13)6-11(20)19-8-14(16,17)18/h9-10H,1-8H2,(H,19,20) |
| InChIKey | WOJKYCPOXSSWFO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|