C20H28N4OS — CID 48843294
1-[1-(2-bicyclo[2.2.1]heptanylcarbamothioyl)piperidin-4-yl]-3-phenylurea (PubChem CID 48843294) has the molecular formula C20H28N4OS and a molecular weight of 372.54 g/mol. Its IUPAC name is 1-[1-(2-bicyclo[2.2.1]heptanylcarbamothioyl)piperidin-4-yl]-3-phenylurea.
| Compound Name | 1-[1-(2-bicyclo[2.2.1]heptanylcarbamothioyl)piperidin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 48843294 |
| Molecular Formula | C20H28N4OS |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-[1-(2-bicyclo[2.2.1]heptanylcarbamothioyl)piperidin-4-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NC1CCN(C(=S)NC2CC3CCC2C3)CC1 |
| InChI | InChI=1S/C20H28N4OS/c25-19(21-16-4-2-1-3-5-16)22-17-8-10-24(11-9-17)20(26)23-18-13-14-6-7-15(18)12-14/h1-5,14-15,17-18H,6-13H2,(H,23,26)(H2,21,22,25) |
| InChIKey | QQSGIQILMVHLDO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|