C20H27N3O2S2 — CID 7041871
N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazine-1-carbothioamide (PubChem CID 7041871) has the molecular formula C20H27N3O2S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 7041871 |
| Molecular Formula | C20H27N3O2S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-4-[(E)-2-phenylethenyl]sulfonylpiperazine-1-carbothioamide |
| SMILES | O=S(=O)(/C=C/c1ccccc1)N1CCN(C(=S)N[C@H]2C[C@@H]3CC[C@@H]2C3)CC1 |
| InChI | InChI=1S/C20H27N3O2S2/c24-27(25,13-8-16-4-2-1-3-5-16)23-11-9-22(10-12-23)20(26)21-19-15-17-6-7-18(19)14-17/h1-5,8,13,17-19H,6-7,9-12,14-15H2,(H,21,26)/b13-8+/t17-,18-,19+/m1/s1 |
| InChIKey | WLWVYXWRSHEDAQ-SIWDMLEESA-N |
| XLogP | 2.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|