C26H36N2O2 — CID 108557565
N-[1-[2-(1-adamantyl)acetyl]piperidin-4-yl]-3,4-dimethylbenzamide (PubChem CID 108557565) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[1-[2-(1-adamantyl)acetyl]piperidin-4-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[1-[2-(1-adamantyl)acetyl]piperidin-4-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 108557565 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | N-[1-[2-(1-adamantyl)acetyl]piperidin-4-yl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(C(=O)CC34CC5CC(CC(C5)C3)C4)CC2)cc1C |
| InChI | InChI=1S/C26H36N2O2/c1-17-3-4-22(9-18(17)2)25(30)27-23-5-7-28(8-6-23)24(29)16-26-13-19-10-20(14-26)12-21(11-19)15-26/h3-4,9,19-21,23H,5-8,10-16H2,1-2H3,(H,27,30) |
| InChIKey | UCEJKGFIQQFIQO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |