C23H38N2O2 — CID 108564229
N-[1-[2-(1-adamantyl)acetyl]piperidin-4-yl]-3,3-dimethylbutanamide (PubChem CID 108564229) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is N-[1-[2-(1-adamantyl)acetyl]piperidin-4-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[1-[2-(1-adamantyl)acetyl]piperidin-4-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 108564229 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | N-[1-[2-(1-adamantyl)acetyl]piperidin-4-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NC1CCN(C(=O)CC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C23H38N2O2/c1-22(2,3)14-20(26)24-19-4-6-25(7-5-19)21(27)15-23-11-16-8-17(12-23)10-18(9-16)13-23/h16-19H,4-15H2,1-3H3,(H,24,26) |
| InChIKey | LXOYVBLTPBYMKU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |