C12H21NO — CID 23314706
(5S,7S)-3-(dimethylamino)adamantan-1-ol (PubChem CID 23314706) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (5S,7S)-3-(dimethylamino)adamantan-1-ol.
| Compound Name | (5S,7S)-3-(dimethylamino)adamantan-1-ol |
|---|---|
| PubChem CID | 23314706 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (5S,7S)-3-(dimethylamino)adamantan-1-ol |
| SMILES | CN(C)C12C[C@@H]3C[C@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C12H21NO/c1-13(2)11-4-9-3-10(5-11)7-12(14,6-9)8-11/h9-10,14H,3-8H2,1-2H3/t9-,10-,11?,12?/m0/s1 |
| InChIKey | XIKNNMKCXVWVTK-JYBOHDQNSA-N |
| XLogP | 1.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |