C13H22O2 — CID 139814591
3,4,5-trimethyladamantane-1,4-diol (PubChem CID 139814591) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 3,4,5-trimethyladamantane-1,4-diol.
| Compound Name | 3,4,5-trimethyladamantane-1,4-diol |
|---|---|
| PubChem CID | 139814591 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 3,4,5-trimethyladamantane-1,4-diol |
| SMILES | CC12CC3CC(O)(C1)CC(C)(C3)C2(C)O |
| InChI | InChI=1S/C13H22O2/c1-10-4-9-5-11(2,12(10,3)14)8-13(15,6-9)7-10/h9,14-15H,4-8H2,1-3H3 |
| InChIKey | BOBCRCYXVTWCMO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |