C12H20O3 — CID 71086173
5-ethoxyadamantane-1,3-diol (PubChem CID 71086173) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 5-ethoxyadamantane-1,3-diol.
| Compound Name | 5-ethoxyadamantane-1,3-diol |
|---|---|
| PubChem CID | 71086173 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 5-ethoxyadamantane-1,3-diol |
| SMILES | CCOC12CC3CC(O)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C12H20O3/c1-2-15-12-5-9-3-10(13,7-12)6-11(14,4-9)8-12/h9,13-14H,2-8H2,1H3 |
| InChIKey | NALBXJUTROBKAS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |