C13H20O2 — CID 141223599
5-prop-1-enyladamantane-1,3-diol (PubChem CID 141223599) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-prop-1-enyladamantane-1,3-diol.
| Compound Name | 5-prop-1-enyladamantane-1,3-diol |
|---|---|
| PubChem CID | 141223599 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 5-prop-1-enyladamantane-1,3-diol |
| SMILES | CC=CC12CC3CC(O)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C13H20O2/c1-2-3-11-4-10-5-12(14,7-11)9-13(15,6-10)8-11/h2-3,10,14-15H,4-9H2,1H3 |
| InChIKey | DKOPBSNDLWLXAE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|