About acetaldehyde;adamantan-1-ol
acetaldehyde;adamantan-1-ol (PubChem CID 175101814) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is acetaldehyde;adamantan-1-ol.
Molecular Properties
| Compound Name | acetaldehyde;adamantan-1-ol |
| PubChem CID | 175101814 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | acetaldehyde;adamantan-1-ol |
| SMILES | CC=O.OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H16O.C2H4O/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-2-3/h7-9,11H,1-6H2;2H,1H3 |
| InChIKey | OPUVAQFKDKSYEZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;adamantan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;adamantan-1-ol?
The IUPAC name of acetaldehyde;adamantan-1-ol (CID 175101814) is acetaldehyde;adamantan-1-ol.
What is the SMILES notation for acetaldehyde;adamantan-1-ol?
The canonical SMILES for acetaldehyde;adamantan-1-ol is CC=O.OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of acetaldehyde;adamantan-1-ol?
The InChIKey is OPUVAQFKDKSYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O.C2H4O/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-2-3/h7-9,11H,1-6H2;2H,1H3.
What are the key properties of acetaldehyde;adamantan-1-ol?
acetaldehyde;adamantan-1-ol has a molecular weight of 196.29 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;adamantan-1-ol is sourced from PubChem (CID 175101814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).