C13H20O2 — CID 102239853
methyl (3S,6R)-tricyclo[4.3.1.13,8]undecane-1-carboxylate (PubChem CID 102239853) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is methyl (3S,6R)-tricyclo[4.3.1.13,8]undecane-1-carboxylate.
| Compound Name | methyl (3S,6R)-tricyclo[4.3.1.13,8]undecane-1-carboxylate |
|---|---|
| PubChem CID | 102239853 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | methyl (3S,6R)-tricyclo[4.3.1.13,8]undecane-1-carboxylate |
| SMILES | COC(=O)C12CC3C[C@@H](CC[C@@H](C3)C1)C2 |
| InChI | InChI=1S/C13H20O2/c1-15-12(14)13-6-9-2-3-10(7-13)5-11(4-9)8-13/h9-11H,2-8H2,1H3/t9-,10+,11?,13? |
| InChIKey | XNEWPPYQNLJNGO-UYVFGJEYSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |