About 2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate
2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate (PubChem CID 2836046) has the molecular formula C16H27NO2
and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate.
Analyze 2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate?
The IUPAC name of 2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate (CID 2836046) is 2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate.
What is the SMILES notation for 2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate?
The canonical SMILES for 2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate is CN(C)CCOC(=O)C12CC3CCC(CC(C3)C1)C2.
What is the InChIKey of 2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate?
The InChIKey is HMPNSQYMTGMMPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO2/c1-17(2)5-6-19-15(18)16-9-12-3-4-13(10-16)8-14(7-12)11-16/h12-14H,3-11H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate?
2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate has a molecular weight of 265.40 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl tricyclo[4.3.1.13,8]undecane-1-carboxylate is sourced from PubChem (CID 2836046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).