C16H21N3O4 — CID 175927527
(4,6-dimethoxy-1,3,5-triazin-2-yl) adamantane-1-carboxylate (PubChem CID 175927527) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is (4,6-dimethoxy-1,3,5-triazin-2-yl) adamantane-1-carboxylate.
| Compound Name | (4,6-dimethoxy-1,3,5-triazin-2-yl) adamantane-1-carboxylate |
|---|---|
| PubChem CID | 175927527 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (4,6-dimethoxy-1,3,5-triazin-2-yl) adamantane-1-carboxylate |
| SMILES | COc1nc(OC)nc(OC(=O)C23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C16H21N3O4/c1-21-13-17-14(22-2)19-15(18-13)23-12(20)16-6-9-3-10(7-16)5-11(4-9)8-16/h9-11H,3-8H2,1-2H3 |
| InChIKey | RRDFDLMZSVNQOE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |