C12H19NO4 — CID 70881719
(2S)-2-amino-2-[(3S)-3,5-dihydroxy-1-adamantyl]acetic acid (PubChem CID 70881719) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is (2S)-2-amino-2-[(3S)-3,5-dihydroxy-1-adamantyl]acetic acid.
| Compound Name | (2S)-2-amino-2-[(3S)-3,5-dihydroxy-1-adamantyl]acetic acid |
|---|---|
| PubChem CID | 70881719 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (2S)-2-amino-2-[(3S)-3,5-dihydroxy-1-adamantyl]acetic acid |
| SMILES | N[C@H](C(=O)O)C12CC3CC(O)(C1)C[C@](O)(C3)C2 |
| InChI | InChI=1S/C12H19NO4/c13-8(9(14)15)10-1-7-2-11(16,4-10)6-12(17,3-7)5-10/h7-8,16-17H,1-6,13H2,(H,14,15)/t7?,8-,10?,11+,12?/m1/s1 |
| InChIKey | DKKBZKRSCJEGAK-NSYHSNMVSA-N |
| XLogP | -0.16 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |