C7H11ClFNO2 — CID 135392726
2-amino-2-(3-fluoro-1-bicyclo[1.1.1]pentanyl)acetic acid;hydrochloride (PubChem CID 135392726) has the molecular formula C7H11ClFNO2 and a molecular weight of 195.62 g/mol. Its IUPAC name is 2-amino-2-(3-fluoro-1-bicyclo[1.1.1]pentanyl)acetic acid;hydrochloride.
| Compound Name | 2-amino-2-(3-fluoro-1-bicyclo[1.1.1]pentanyl)acetic acid;hydrochloride |
|---|---|
| PubChem CID | 135392726 |
| Molecular Formula | C7H11ClFNO2 |
| Molecular Weight | 195.62 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2-amino-2-(3-fluoro-1-bicyclo[1.1.1]pentanyl)acetic acid;hydrochloride |
| SMILES | Cl.NC(C(=O)O)C12CC(F)(C1)C2 |
| InChI | InChI=1S/C7H10FNO2.ClH/c8-7-1-6(2-7,3-7)4(9)5(10)11;/h4H,1-3,9H2,(H,10,11);1H |
| InChIKey | RLKODNJPSBVIAI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.62 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |