C15H20O5 — CID 68786296
3-(2-carboxyprop-1-enyl)-5-hydroxyadamantane-1-carboxylic acid (PubChem CID 68786296) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-(2-carboxyprop-1-enyl)-5-hydroxyadamantane-1-carboxylic acid.
| Compound Name | 3-(2-carboxyprop-1-enyl)-5-hydroxyadamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 68786296 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-(2-carboxyprop-1-enyl)-5-hydroxyadamantane-1-carboxylic acid |
| SMILES | CC(=CC12CC3CC(O)(C1)CC(C(=O)O)(C3)C2)C(=O)O |
| InChI | InChI=1S/C15H20O5/c1-9(11(16)17)2-13-3-10-4-14(6-13,12(18)19)8-15(20,5-10)7-13/h2,10,20H,3-8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | VEGSJLHUNZZZDN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|