C14H22O4 — CID 53445274
adamantane-1,3-diol;2-methylprop-2-enoic acid (PubChem CID 53445274) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is adamantane-1,3-diol;2-methylprop-2-enoic acid.
| Compound Name | adamantane-1,3-diol;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 53445274 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | adamantane-1,3-diol;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.OC12CC3CC(C1)CC(O)(C3)C2 |
| InChI | InChI=1S/C10H16O2.C4H6O2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9;1-3(2)4(5)6/h7-8,11-12H,1-6H2;1H2,2H3,(H,5,6) |
| InChIKey | VRIRZCASKFIYQJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|