C14H19O3- — CID 131731369
3-(3-hydroxy-1-adamantyl)-2-methylprop-2-enoate (PubChem CID 131731369) has the molecular formula C14H19O3- and a molecular weight of 235.30 g/mol. Its IUPAC name is 3-(3-hydroxy-1-adamantyl)-2-methylprop-2-enoate.
| Compound Name | 3-(3-hydroxy-1-adamantyl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 131731369 |
| Molecular Formula | C14H19O3- |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 3-(3-hydroxy-1-adamantyl)-2-methylprop-2-enoate |
| SMILES | CC(=CC12CC3CC(CC(O)(C3)C1)C2)C(=O)[O-] |
| InChI | InChI=1S/C14H20O3/c1-9(12(15)16)3-13-4-10-2-11(5-13)7-14(17,6-10)8-13/h3,10-11,17H,2,4-8H2,1H3,(H,15,16)/p-1 |
| InChIKey | SRIHRICJBRJJDQ-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|