About N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide
N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide (PubChem CID 98051722) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide.
Molecular Properties
| Compound Name | N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide |
| PubChem CID | 98051722 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide |
| SMILES | CC(=O)NC12C[C@@H]3C[C@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C12H19NO2/c1-8(14)13-11-3-9-2-10(4-11)6-12(15,5-9)7-11/h9-10,15H,2-7H2,1H3,(H,13,14)/t9-,10-,11?,12?/m0/s1 |
| InChIKey | QGQQCWHALQYFDK-JYBOHDQNSA-N |
| XLogP | 1.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide?
The IUPAC name of N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide (CID 98051722) is N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide.
What is the SMILES notation for N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide?
The canonical SMILES for N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide is CC(=O)NC12C[C@@H]3C[C@H](CC(O)(C3)C1)C2.
What is the InChIKey of N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide?
The InChIKey is QGQQCWHALQYFDK-JYBOHDQNSA-N. The full InChI is InChI=1S/C12H19NO2/c1-8(14)13-11-3-9-2-10(4-11)6-12(15,5-9)7-11/h9-10,15H,2-7H2,1H3,(H,13,14)/t9-,10-,11?,12?/m0/s1.
What are the key properties of N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide?
N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide has a molecular weight of 209.29 g/mol, XLogP of 1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5S,7S)-3-hydroxy-1-adamantyl]acetamide is sourced from PubChem (CID 98051722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).