C18H25NO3 — CID 128664610
(1R,4S)-N-(3-hydroxy-1-adamantyl)-6-oxobicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 128664610) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (1R,4S)-N-(3-hydroxy-1-adamantyl)-6-oxobicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,4S)-N-(3-hydroxy-1-adamantyl)-6-oxobicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 128664610 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (1R,4S)-N-(3-hydroxy-1-adamantyl)-6-oxobicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(O)(C3)C1)C2)C1C[C@H]2CC(=O)[C@@H]1C2 |
| InChI | InChI=1S/C18H25NO3/c20-15-4-10-2-13(15)14(3-10)16(21)19-17-5-11-1-12(6-17)8-18(22,7-11)9-17/h10-14,22H,1-9H2,(H,19,21)/t10-,11?,12?,13+,14?,17?,18?/m0/s1 |
| InChIKey | SPVZIQQJLBLUQC-OPQHDKSQSA-N |
| XLogP | 1.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |