C16H21ClN2O2S — CID 132971584
1-[(5-chlorothiophen-2-yl)methyl]-3-(3-hydroxy-1-adamantyl)urea (PubChem CID 132971584) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-3-(3-hydroxy-1-adamantyl)urea.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-(3-hydroxy-1-adamantyl)urea |
|---|---|
| PubChem CID | 132971584 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-(3-hydroxy-1-adamantyl)urea |
| SMILES | O=C(NCc1ccc(Cl)s1)NC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C16H21ClN2O2S/c17-13-2-1-12(22-13)8-18-14(20)19-15-4-10-3-11(5-15)7-16(21,6-10)9-15/h1-2,10-11,21H,3-9H2,(H2,18,19,20) |
| InChIKey | LJJBFOJZBOLADI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |