C14H18N2OS — CID 71031668
1-(thiophen-2-ylmethyl)-3-(3-tricyclo[3.1.1.11,3]octanyl)urea (PubChem CID 71031668) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 1-(thiophen-2-ylmethyl)-3-(3-tricyclo[3.1.1.11,3]octanyl)urea.
| Compound Name | 1-(thiophen-2-ylmethyl)-3-(3-tricyclo[3.1.1.11,3]octanyl)urea |
|---|---|
| PubChem CID | 71031668 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-(thiophen-2-ylmethyl)-3-(3-tricyclo[3.1.1.11,3]octanyl)urea |
| SMILES | O=C(NCc1cccs1)NC12CC3CC(C3)(C1)C2 |
| InChI | InChI=1S/C14H18N2OS/c17-12(15-7-11-2-1-3-18-11)16-14-6-10-4-13(5-10,8-14)9-14/h1-3,10H,4-9H2,(H2,15,16,17) |
| InChIKey | SIRGWPUWYUBKEY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |