C17H24ClN2OS- — CID 53350955
N-(1-adamantyl)-2-(thiophen-2-ylmethylamino)acetamide chloride (PubChem CID 53350955) has the molecular formula C17H24ClN2OS- and a molecular weight of 339.91 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(thiophen-2-ylmethylamino)acetamide chloride.
| Compound Name | N-(1-adamantyl)-2-(thiophen-2-ylmethylamino)acetamide chloride |
|---|---|
| PubChem CID | 53350955 |
| Molecular Formula | C17H24ClN2OS- |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(1-adamantyl)-2-(thiophen-2-ylmethylamino)acetamide chloride |
| SMILES | O=C(CNCc1cccs1)NC12CC3CC(CC(C3)C1)C2.[Cl-] |
| InChI | InChI=1S/C17H24N2OS.ClH/c20-16(11-18-10-15-2-1-3-21-15)19-17-7-12-4-13(8-17)6-14(5-12)9-17;/h1-3,12-14,18H,4-11H2,(H,19,20);1H/p-1 |
| InChIKey | VEOGDNMKXREGLY-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |