C17H22N2O2S — CID 2869572
N'-(2-thiophen-2-ylacetyl)adamantane-1-carbohydrazide (PubChem CID 2869572) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is N'-(2-thiophen-2-ylacetyl)adamantane-1-carbohydrazide.
| Compound Name | N'-(2-thiophen-2-ylacetyl)adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 2869572 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N'-(2-thiophen-2-ylacetyl)adamantane-1-carbohydrazide |
| SMILES | O=C(Cc1cccs1)NNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H22N2O2S/c20-15(7-14-2-1-3-22-14)18-19-16(21)17-8-11-4-12(9-17)6-13(5-11)10-17/h1-3,11-13H,4-10H2,(H,18,20)(H,19,21) |
| InChIKey | NUNNWDDHKJCFTE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|