C19H28ClN2OS+ — CID 9293505
[2-(1-adamantylmethylamino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-methylazanium (PubChem CID 9293505) has the molecular formula C19H28ClN2OS+ and a molecular weight of 367.97 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-methylazanium.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9293505 |
| Molecular Formula | C19H28ClN2OS+ |
| Molecular Weight | 367.97 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NCC12CC3CC(CC(C3)C1)C2)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C19H27ClN2OS/c1-22(10-16-2-3-17(20)24-16)11-18(23)21-12-19-7-13-4-14(8-19)6-15(5-13)9-19/h2-3,13-15H,4-12H2,1H3,(H,21,23)/p+1 |
| InChIKey | XZLLTVPZNWNPKJ-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.97 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |