C18H28N2O4 — CID 122023903
4-[(3-hydroxy-1-adamantyl)carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122023903) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 4-[(3-hydroxy-1-adamantyl)carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3-hydroxy-1-adamantyl)carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122023903 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-[(3-hydroxy-1-adamantyl)carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1CCC(C(=O)O)CC1)NC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C18H28N2O4/c21-15(22)13-1-3-14(4-2-13)19-16(23)20-17-6-11-5-12(7-17)9-18(24,8-11)10-17/h11-14,24H,1-10H2,(H,21,22)(H2,19,20,23) |
| InChIKey | JCQOLWNMCAICGG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |