C17H22ClNO — CID 98296417
(5R,7R)-3-[(2-chlorophenyl)methylamino]adamantan-1-ol (PubChem CID 98296417) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is (5R,7R)-3-[(2-chlorophenyl)methylamino]adamantan-1-ol.
| Compound Name | (5R,7R)-3-[(2-chlorophenyl)methylamino]adamantan-1-ol |
|---|---|
| PubChem CID | 98296417 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (5R,7R)-3-[(2-chlorophenyl)methylamino]adamantan-1-ol |
| SMILES | OC12C[C@@H]3C[C@@H](C1)CC(NCc1ccccc1Cl)(C3)C2 |
| InChI | InChI=1S/C17H22ClNO/c18-15-4-2-1-3-14(15)10-19-16-6-12-5-13(7-16)9-17(20,8-12)11-16/h1-4,12-13,19-20H,5-11H2/t12-,13-,16?,17?/m1/s1 |
| InChIKey | CYZNIZROQNXYQL-QJRTVWDNSA-N |
| XLogP | 3.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |