C17H21Cl2N — CID 4721689
N-[(2,6-dichlorophenyl)methyl]adamantan-1-amine (PubChem CID 4721689) has the molecular formula C17H21Cl2N and a molecular weight of 310.27 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]adamantan-1-amine.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]adamantan-1-amine |
|---|---|
| PubChem CID | 4721689 |
| Molecular Formula | C17H21Cl2N |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]adamantan-1-amine |
| SMILES | Clc1cccc(Cl)c1CNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H21Cl2N/c18-15-2-1-3-16(19)14(15)10-20-17-7-11-4-12(8-17)6-13(5-11)9-17/h1-3,11-13,20H,4-10H2 |
| InChIKey | IGWRBERYIPFFDB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |