C21H24ClNO — CID 4723694
N-[[5-(3-chlorophenyl)furan-2-yl]methyl]adamantan-1-amine (PubChem CID 4723694) has the molecular formula C21H24ClNO and a molecular weight of 341.88 g/mol. Its IUPAC name is N-[[5-(3-chlorophenyl)furan-2-yl]methyl]adamantan-1-amine.
| Compound Name | N-[[5-(3-chlorophenyl)furan-2-yl]methyl]adamantan-1-amine |
|---|---|
| PubChem CID | 4723694 |
| Molecular Formula | C21H24ClNO |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-[[5-(3-chlorophenyl)furan-2-yl]methyl]adamantan-1-amine |
| SMILES | Clc1cccc(-c2ccc(CNC34CC5CC(CC(C5)C3)C4)o2)c1 |
| InChI | InChI=1S/C21H24ClNO/c22-18-3-1-2-17(9-18)20-5-4-19(24-20)13-23-21-10-14-6-15(11-21)8-16(7-14)12-21/h1-5,9,14-16,23H,6-8,10-13H2 |
| InChIKey | PGJARRUCELISIW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |