C16H19ClNO+ — CID 8622800
[5-(3-chlorophenyl)furan-2-yl]methyl-cyclopentylazanium (PubChem CID 8622800) has the molecular formula C16H19ClNO+ and a molecular weight of 276.79 g/mol. Its IUPAC name is [5-(3-chlorophenyl)furan-2-yl]methyl-cyclopentylazanium.
| Compound Name | [5-(3-chlorophenyl)furan-2-yl]methyl-cyclopentylazanium |
|---|---|
| PubChem CID | 8622800 |
| Molecular Formula | C16H19ClNO+ |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [5-(3-chlorophenyl)furan-2-yl]methyl-cyclopentylazanium |
| SMILES | Clc1cccc(-c2ccc(C[NH2+]C3CCCC3)o2)c1 |
| InChI | InChI=1S/C16H18ClNO/c17-13-5-3-4-12(10-13)16-9-8-15(19-16)11-18-14-6-1-2-7-14/h3-5,8-10,14,18H,1-2,6-7,11H2/p+1 |
| InChIKey | GMIQRHSYDGDYIU-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |