C19H24Cl2NO+ — CID 8637118
cyclooctyl-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]azanium (PubChem CID 8637118) has the molecular formula C19H24Cl2NO+ and a molecular weight of 353.31 g/mol. Its IUPAC name is cyclooctyl-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]azanium.
| Compound Name | cyclooctyl-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8637118 |
| Molecular Formula | C19H24Cl2NO+ |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | cyclooctyl-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]azanium |
| SMILES | Clc1ccc(-c2ccc(C[NH2+]C3CCCCCCC3)o2)c(Cl)c1 |
| InChI | InChI=1S/C19H23Cl2NO/c20-14-8-10-17(18(21)12-14)19-11-9-16(23-19)13-22-15-6-4-2-1-3-5-7-15/h8-12,15,22H,1-7,13H2/p+1 |
| InChIKey | WSDYBKCNMWCCLB-UHFFFAOYSA-O |
| XLogP | 5.43 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |