C19H26NO2+ — CID 7425297
cyclohexyl-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl]azanium (PubChem CID 7425297) has the molecular formula C19H26NO2+ and a molecular weight of 300.42 g/mol. Its IUPAC name is cyclohexyl-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl]azanium.
| Compound Name | cyclohexyl-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7425297 |
| Molecular Formula | C19H26NO2+ |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | cyclohexyl-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl]azanium |
| SMILES | C[C@H](O)c1ccc(-c2ccc(C[NH2+]C3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C19H25NO2/c1-14(21)15-7-9-16(10-8-15)19-12-11-18(22-19)13-20-17-5-3-2-4-6-17/h7-12,14,17,20-21H,2-6,13H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | XYUDIGTVULNWDH-AWEZNQCLSA-O |
| XLogP | 3.40 |
| TPSA | 49.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |