C18H24NO3+ — CID 8639058
[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 8639058) has the molecular formula C18H24NO3+ and a molecular weight of 302.39 g/mol. Its IUPAC name is [5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | [5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8639058 |
| Molecular Formula | C18H24NO3+ |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | [5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | C[C@H](O)c1ccc(-c2ccc(C[NH2+]C[C@H]3CCCO3)o2)cc1 |
| InChI | InChI=1S/C18H23NO3/c1-13(20)14-4-6-15(7-5-14)18-9-8-17(22-18)12-19-11-16-3-2-10-21-16/h4-9,13,16,19-20H,2-3,10-12H2,1H3/p+1/t13-,16+/m0/s1 |
| InChIKey | URMYNGAXHBPSJY-XJKSGUPXSA-O |
| XLogP | 2.24 |
| TPSA | 59.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |