C20H21ClNO2+ — CID 8638991
(2-chlorophenyl)methyl-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl]azanium (PubChem CID 8638991) has the molecular formula C20H21ClNO2+ and a molecular weight of 342.85 g/mol. Its IUPAC name is (2-chlorophenyl)methyl-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl]azanium.
| Compound Name | (2-chlorophenyl)methyl-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8638991 |
| Molecular Formula | C20H21ClNO2+ |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (2-chlorophenyl)methyl-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methyl]azanium |
| SMILES | C[C@H](O)c1ccc(-c2ccc(C[NH2+]Cc3ccccc3Cl)o2)cc1 |
| InChI | InChI=1S/C20H20ClNO2/c1-14(23)15-6-8-16(9-7-15)20-11-10-18(24-20)13-22-12-17-4-2-3-5-19(17)21/h2-11,14,22-23H,12-13H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | HZCWQBJUNNBCOE-AWEZNQCLSA-O |
| XLogP | 3.92 |
| TPSA | 49.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |