C20H19ClNO3+ — CID 8636553
(2-chlorophenyl)methyl-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methyl]azanium (PubChem CID 8636553) has the molecular formula C20H19ClNO3+ and a molecular weight of 356.83 g/mol. Its IUPAC name is (2-chlorophenyl)methyl-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methyl]azanium.
| Compound Name | (2-chlorophenyl)methyl-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8636553 |
| Molecular Formula | C20H19ClNO3+ |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2-chlorophenyl)methyl-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methyl]azanium |
| SMILES | COC(=O)c1ccc(-c2ccc(C[NH2+]Cc3ccccc3Cl)o2)cc1 |
| InChI | InChI=1S/C20H18ClNO3/c1-24-20(23)15-8-6-14(7-9-15)19-11-10-17(25-19)13-22-12-16-4-2-3-5-18(16)21/h2-11,22H,12-13H2,1H3/p+1 |
| InChIKey | GATUGWISHPHGLS-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |