C23H28NO3+ — CID 8636389
1-adamantyl-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methyl]azanium (PubChem CID 8636389) has the molecular formula C23H28NO3+ and a molecular weight of 366.48 g/mol. Its IUPAC name is 1-adamantyl-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methyl]azanium.
| Compound Name | 1-adamantyl-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8636389 |
| Molecular Formula | C23H28NO3+ |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-adamantyl-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methyl]azanium |
| SMILES | COC(=O)c1ccc(-c2ccc(C[NH2+]C34CC5CC(CC(C5)C3)C4)o2)cc1 |
| InChI | InChI=1S/C23H27NO3/c1-26-22(25)19-4-2-18(3-5-19)21-7-6-20(27-21)14-24-23-11-15-8-16(12-23)10-17(9-15)13-23/h2-7,15-17,24H,8-14H2,1H3/p+1 |
| InChIKey | HRKJPRWLABDQKL-UHFFFAOYSA-O |
| XLogP | 3.77 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |