C18H26N2O4+2 — CID 8637015
[(2R)-2-hydroxypropyl]-[2-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methylazaniumyl]ethyl]azanium (PubChem CID 8637015) has the molecular formula C18H26N2O4+2 and a molecular weight of 334.42 g/mol. Its IUPAC name is [(2R)-2-hydroxypropyl]-[2-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methylazaniumyl]ethyl]azanium.
| Compound Name | [(2R)-2-hydroxypropyl]-[2-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methylazaniumyl]ethyl]azanium |
|---|---|
| PubChem CID | 8637015 |
| Molecular Formula | C18H26N2O4+2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [(2R)-2-hydroxypropyl]-[2-[[5-(4-methoxycarbonylphenyl)furan-2-yl]methylazaniumyl]ethyl]azanium |
| SMILES | COC(=O)c1ccc(-c2ccc(C[NH2+]CC[NH2+]C[C@@H](C)O)o2)cc1 |
| InChI | InChI=1S/C18H24N2O4/c1-13(21)11-19-9-10-20-12-16-7-8-17(24-16)14-3-5-15(6-4-14)18(22)23-2/h3-8,13,19-21H,9-12H2,1-2H3/p+2/t13-/m1/s1 |
| InChIKey | JCBYQZGVQOOETB-CYBMUJFWSA-P |
| XLogP | -0.26 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|