C24H28NO5+ — CID 8617227
2-(3,4-dimethoxyphenyl)ethyl-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methyl]azanium (PubChem CID 8617227) has the molecular formula C24H28NO5+ and a molecular weight of 410.49 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methyl]azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8617227 |
| Molecular Formula | C24H28NO5+ |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methyl]azanium |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C[NH2+]CCc3ccc(OC)c(OC)c3)o2)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-4-29-24(26)19-8-6-18(7-9-19)21-12-10-20(30-21)16-25-14-13-17-5-11-22(27-2)23(15-17)28-3/h5-12,15,25H,4,13-14,16H2,1-3H3/p+1 |
| InChIKey | MKEOJELKHUTDDK-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 74.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|