C23H25NO5 — CID 26415345
3-[5-[[2-(3,4-dimethoxyphenyl)ethylazaniumyl]methyl]furan-2-yl]-2-methylbenzoate (PubChem CID 26415345) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[5-[[2-(3,4-dimethoxyphenyl)ethylazaniumyl]methyl]furan-2-yl]-2-methylbenzoate.
| Compound Name | 3-[5-[[2-(3,4-dimethoxyphenyl)ethylazaniumyl]methyl]furan-2-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 26415345 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-[5-[[2-(3,4-dimethoxyphenyl)ethylazaniumyl]methyl]furan-2-yl]-2-methylbenzoate |
| SMILES | COc1ccc(CC[NH2+]Cc2ccc(-c3cccc(C(=O)[O-])c3C)o2)cc1OC |
| InChI | InChI=1S/C23H25NO5/c1-15-18(5-4-6-19(15)23(25)26)20-10-8-17(29-20)14-24-12-11-16-7-9-21(27-2)22(13-16)28-3/h4-10,13,24H,11-12,14H2,1-3H3,(H,25,26) |
| InChIKey | BUQJMXDNLLMWBA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|