C15H19ClNO2+ — CID 7425255
[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl-propylazanium (PubChem CID 7425255) has the molecular formula C15H19ClNO2+ and a molecular weight of 280.78 g/mol. Its IUPAC name is [5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl-propylazanium.
| Compound Name | [5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl-propylazanium |
|---|---|
| PubChem CID | 7425255 |
| Molecular Formula | C15H19ClNO2+ |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | [5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl-propylazanium |
| SMILES | CCC[NH2+]Cc1ccc(-c2ccc(OC)c(Cl)c2)o1 |
| InChI | InChI=1S/C15H18ClNO2/c1-3-8-17-10-12-5-7-14(19-12)11-4-6-15(18-2)13(16)9-11/h4-7,9,17H,3,8,10H2,1-2H3/p+1 |
| InChIKey | AWGQKFWPLBIQHY-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|